C17H26Cl2N2O — CID 120562365
4-amino-N-[(2-chlorophenyl)methyl]-N-cyclopentylpentanamide;hydrochloride (PubChem CID 120562365) has the molecular formula C17H26Cl2N2O and a molecular weight of 345.31 g/mol. Its IUPAC name is 4-amino-N-[(2-chlorophenyl)methyl]-N-cyclopentylpentanamide;hydrochloride.
| Compound Name | 4-amino-N-[(2-chlorophenyl)methyl]-N-cyclopentylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 120562365 |
| Molecular Formula | C17H26Cl2N2O |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-amino-N-[(2-chlorophenyl)methyl]-N-cyclopentylpentanamide;hydrochloride |
| SMILES | CC(N)CCC(=O)N(Cc1ccccc1Cl)C1CCCC1.Cl |
| InChI | InChI=1S/C17H25ClN2O.ClH/c1-13(19)10-11-17(21)20(15-7-3-4-8-15)12-14-6-2-5-9-16(14)18;/h2,5-6,9,13,15H,3-4,7-8,10-12,19H2,1H3;1H |
| InChIKey | NHARXRCQWQEAJA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |