C22H28ClN3O2 — CID 42700833
N-[(2-chloroquinolin-3-yl)methyl]-N-(2-morpholin-4-ylethyl)cyclopentanecarboxamide (PubChem CID 42700833) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is N-[(2-chloroquinolin-3-yl)methyl]-N-(2-morpholin-4-ylethyl)cyclopentanecarboxamide.
| Compound Name | N-[(2-chloroquinolin-3-yl)methyl]-N-(2-morpholin-4-ylethyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42700833 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[(2-chloroquinolin-3-yl)methyl]-N-(2-morpholin-4-ylethyl)cyclopentanecarboxamide |
| SMILES | O=C(C1CCCC1)N(CCN1CCOCC1)Cc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C22H28ClN3O2/c23-21-19(15-18-7-3-4-8-20(18)24-21)16-26(22(27)17-5-1-2-6-17)10-9-25-11-13-28-14-12-25/h3-4,7-8,15,17H,1-2,5-6,9-14,16H2 |
| InChIKey | IAUVQJSJLIGQGB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|