C25H35IN4O2 — CID 67404636
N-[[1-(iodomethyl)-2-oxoquinolin-3-yl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]cyclohexanecarboxamide (PubChem CID 67404636) has the molecular formula C25H35IN4O2 and a molecular weight of 550.49 g/mol. Its IUPAC name is N-[[1-(iodomethyl)-2-oxoquinolin-3-yl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]cyclohexanecarboxamide.
| Compound Name | N-[[1-(iodomethyl)-2-oxoquinolin-3-yl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 67404636 |
| Molecular Formula | C25H35IN4O2 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | N-[[1-(iodomethyl)-2-oxoquinolin-3-yl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]cyclohexanecarboxamide |
| SMILES | CN1CCN(CCN(Cc2cc3ccccc3n(CI)c2=O)C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C25H35IN4O2/c1-27-11-13-28(14-12-27)15-16-29(24(31)20-7-3-2-4-8-20)18-22-17-21-9-5-6-10-23(21)30(19-26)25(22)32/h5-6,9-10,17,20H,2-4,7-8,11-16,18-19H2,1H3 |
| InChIKey | NRBHOXHNCMWLFE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|