C26H38N2O4 — CID 42701292
N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-3,5-dimethoxy-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 42701292) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-3,5-dimethoxy-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-3,5-dimethoxy-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 42701292 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-3,5-dimethoxy-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(CCCN2CCOCC2)CC2=CCC3CC2C3(C)C)c1 |
| InChI | InChI=1S/C26H38N2O4/c1-26(2)21-7-6-19(24(26)16-21)18-28(9-5-8-27-10-12-32-13-11-27)25(29)20-14-22(30-3)17-23(15-20)31-4/h6,14-15,17,21,24H,5,7-13,16,18H2,1-4H3 |
| InChIKey | UWPMSXNMSSUORU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|