C26H26ClF3N4O3 — CID 42701898
3-(3-chlorophenyl)-1-[3-[(4-ethoxyphenyl)carbamoylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea (PubChem CID 42701898) has the molecular formula C26H26ClF3N4O3 and a molecular weight of 534.97 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[3-[(4-ethoxyphenyl)carbamoylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 3-(3-chlorophenyl)-1-[3-[(4-ethoxyphenyl)carbamoylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42701898 |
| Molecular Formula | C26H26ClF3N4O3 |
| Molecular Weight | 534.97 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[3-[(4-ethoxyphenyl)carbamoylamino]propyl]-1-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CCOc1ccc(NC(=O)NCCCN(C(=O)Nc2cccc(Cl)c2)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C26H26ClF3N4O3/c1-2-37-23-12-10-20(11-13-23)32-24(35)31-14-5-15-34(22-9-3-6-18(16-22)26(28,29)30)25(36)33-21-8-4-7-19(27)17-21/h3-4,6-13,16-17H,2,5,14-15H2,1H3,(H,33,36)(H2,31,32,35) |
| InChIKey | QOCLXQIVNZXJCJ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.97 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|