C23H27F3N2O2 — CID 42701944
2-methyl-N-[3-(3-methylbutanoylamino)propyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 42701944) has the molecular formula C23H27F3N2O2 and a molecular weight of 420.48 g/mol. Its IUPAC name is 2-methyl-N-[3-(3-methylbutanoylamino)propyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-methyl-N-[3-(3-methylbutanoylamino)propyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 42701944 |
| Molecular Formula | C23H27F3N2O2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-methyl-N-[3-(3-methylbutanoylamino)propyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N(CCCNC(=O)CC(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H27F3N2O2/c1-16(2)14-21(29)27-12-7-13-28(22(30)20-11-5-4-8-17(20)3)19-10-6-9-18(15-19)23(24,25)26/h4-6,8-11,15-16H,7,12-14H2,1-3H3,(H,27,29) |
| InChIKey | BFKZIYJLIZTOSA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|