C25H32N2O2 — CID 42704160
N-(2,3-dihydro-1H-inden-5-yl)-3-methyl-2-(2-phenylbutanoylamino)pentanamide (PubChem CID 42704160) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-3-methyl-2-(2-phenylbutanoylamino)pentanamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-3-methyl-2-(2-phenylbutanoylamino)pentanamide |
|---|---|
| PubChem CID | 42704160 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-3-methyl-2-(2-phenylbutanoylamino)pentanamide |
| SMILES | CCC(C(=O)NC(C(=O)Nc1ccc2c(c1)CCC2)C(C)CC)c1ccccc1 |
| InChI | InChI=1S/C25H32N2O2/c1-4-17(3)23(27-24(28)22(5-2)19-10-7-6-8-11-19)25(29)26-21-15-14-18-12-9-13-20(18)16-21/h6-8,10-11,14-17,22-23H,4-5,9,12-13H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | IGPXLZJRQFKQGS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |