C33H46N2O5 — CID 42705612
N-[(1-heptanoylpiperidin-4-yl)methyl]-3,4,5-trimethoxy-N-[(E)-2-methyl-3-phenylprop-2-enyl]benzamide (PubChem CID 42705612) has the molecular formula C33H46N2O5 and a molecular weight of 550.74 g/mol. Its IUPAC name is N-[(1-heptanoylpiperidin-4-yl)methyl]-3,4,5-trimethoxy-N-[(E)-2-methyl-3-phenylprop-2-enyl]benzamide.
| Compound Name | N-[(1-heptanoylpiperidin-4-yl)methyl]-3,4,5-trimethoxy-N-[(E)-2-methyl-3-phenylprop-2-enyl]benzamide |
|---|---|
| PubChem CID | 42705612 |
| Molecular Formula | C33H46N2O5 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | N-[(1-heptanoylpiperidin-4-yl)methyl]-3,4,5-trimethoxy-N-[(E)-2-methyl-3-phenylprop-2-enyl]benzamide |
| SMILES | CCCCCCC(=O)N1CCC(CN(C/C(C)=C/c2ccccc2)C(=O)c2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C33H46N2O5/c1-6-7-8-12-15-31(36)34-18-16-27(17-19-34)24-35(23-25(2)20-26-13-10-9-11-14-26)33(37)28-21-29(38-3)32(40-5)30(22-28)39-4/h9-11,13-14,20-22,27H,6-8,12,15-19,23-24H2,1-5H3/b25-20+ |
| InChIKey | ZKEHWBGKXQFQPN-LKUDQCMESA-N |
| XLogP | 6.47 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|