C32H44N2O3 — CID 3653521
N-[[1-(3-methoxybenzoyl)piperidin-4-yl]methyl]-N-(2-methyl-3-phenylprop-2-enyl)octanamide (PubChem CID 3653521) has the molecular formula C32H44N2O3 and a molecular weight of 504.72 g/mol. Its IUPAC name is N-[[1-(3-methoxybenzoyl)piperidin-4-yl]methyl]-N-(2-methyl-3-phenylprop-2-enyl)octanamide.
| Compound Name | N-[[1-(3-methoxybenzoyl)piperidin-4-yl]methyl]-N-(2-methyl-3-phenylprop-2-enyl)octanamide |
|---|---|
| PubChem CID | 3653521 |
| Molecular Formula | C32H44N2O3 |
| Molecular Weight | 504.72 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | N-[[1-(3-methoxybenzoyl)piperidin-4-yl]methyl]-N-(2-methyl-3-phenylprop-2-enyl)octanamide |
| SMILES | CCCCCCCC(=O)N(CC(C)=Cc1ccccc1)CC1CCN(C(=O)c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C32H44N2O3/c1-4-5-6-7-11-17-31(35)34(24-26(2)22-27-13-9-8-10-14-27)25-28-18-20-33(21-19-28)32(36)29-15-12-16-30(23-29)37-3/h8-10,12-16,22-23,28H,4-7,11,17-21,24-25H2,1-3H3 |
| InChIKey | WXBZCJJJHLDYES-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.72 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|