C24H29N3O4 — CID 42705712
N-[3-[N-(cyclohexanecarbonyl)anilino]propyl]-4-methyl-3-nitrobenzamide (PubChem CID 42705712) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is N-[3-[N-(cyclohexanecarbonyl)anilino]propyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[3-[N-(cyclohexanecarbonyl)anilino]propyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 42705712 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | N-[3-[N-(cyclohexanecarbonyl)anilino]propyl]-4-methyl-3-nitrobenzamide |
| SMILES | Cc1ccc(C(=O)NCCCN(C(=O)C2CCCCC2)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H29N3O4/c1-18-13-14-20(17-22(18)27(30)31)23(28)25-15-8-16-26(21-11-6-3-7-12-21)24(29)19-9-4-2-5-10-19/h3,6-7,11-14,17,19H,2,4-5,8-10,15-16H2,1H3,(H,25,28) |
| InChIKey | GIFOKVXIIYFRGS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|