C27H24ClFN2O3 — CID 42706194
N-[(2-chloroquinolin-3-yl)methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-fluorobenzamide (PubChem CID 42706194) has the molecular formula C27H24ClFN2O3 and a molecular weight of 478.95 g/mol. Its IUPAC name is N-[(2-chloroquinolin-3-yl)methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-fluorobenzamide.
| Compound Name | N-[(2-chloroquinolin-3-yl)methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 42706194 |
| Molecular Formula | C27H24ClFN2O3 |
| Molecular Weight | 478.95 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | N-[(2-chloroquinolin-3-yl)methyl]-N-[2-(3,4-dimethoxyphenyl)ethyl]-4-fluorobenzamide |
| SMILES | COc1ccc(CCN(Cc2cc3ccccc3nc2Cl)C(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C27H24ClFN2O3/c1-33-24-12-7-18(15-25(24)34-2)13-14-31(27(32)19-8-10-22(29)11-9-19)17-21-16-20-5-3-4-6-23(20)30-26(21)28/h3-12,15-16H,13-14,17H2,1-2H3 |
| InChIKey | SFGALVGZAUSVEY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.95 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|