C23H26F3N3O4 — CID 42707289
ethyl 4-[[3-methyl-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]pentanoyl]amino]benzoate (PubChem CID 42707289) has the molecular formula C23H26F3N3O4 and a molecular weight of 465.47 g/mol. Its IUPAC name is ethyl 4-[[3-methyl-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]pentanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-methyl-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]pentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 42707289 |
| Molecular Formula | C23H26F3N3O4 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | ethyl 4-[[3-methyl-2-[[3-(trifluoromethyl)phenyl]carbamoylamino]pentanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(NC(=O)Nc2cccc(C(F)(F)F)c2)C(C)CC)cc1 |
| InChI | InChI=1S/C23H26F3N3O4/c1-4-14(3)19(20(30)27-17-11-9-15(10-12-17)21(31)33-5-2)29-22(32)28-18-8-6-7-16(13-18)23(24,25)26/h6-14,19H,4-5H2,1-3H3,(H,27,30)(H2,28,29,32) |
| InChIKey | FVTJCKILXCCREG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |