C21H25BrN4O — CID 42709157
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-(3-bromophenyl)-1-(3-imidazol-1-ylpropyl)urea (PubChem CID 42709157) has the molecular formula C21H25BrN4O and a molecular weight of 429.36 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-(3-bromophenyl)-1-(3-imidazol-1-ylpropyl)urea.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-(3-bromophenyl)-1-(3-imidazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 42709157 |
| Molecular Formula | C21H25BrN4O |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-(3-bromophenyl)-1-(3-imidazol-1-ylpropyl)urea |
| SMILES | O=C(Nc1cccc(Br)c1)N(CCCn1ccnc1)CC1CC2C=CC1C2 |
| InChI | InChI=1S/C21H25BrN4O/c22-19-3-1-4-20(13-19)24-21(27)26(9-2-8-25-10-7-23-15-25)14-18-12-16-5-6-17(18)11-16/h1,3-7,10,13,15-18H,2,8-9,11-12,14H2,(H,24,27) |
| InChIKey | MZDBHARCVSTNQK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|