C31H31N3O3S2 — CID 42709176
N-(1-benzylpiperidin-4-yl)-N-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methyl]thiophene-2-carboxamide (PubChem CID 42709176) has the molecular formula C31H31N3O3S2 and a molecular weight of 557.74 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methyl]thiophene-2-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42709176 |
| Molecular Formula | C31H31N3O3S2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(Sc2ccc([N+](=O)[O-])cc2CN(C(=O)c2cccs2)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H31N3O3S2/c1-23-9-12-28(13-10-23)39-29-14-11-27(34(36)37)20-25(29)22-33(31(35)30-8-5-19-38-30)26-15-17-32(18-16-26)21-24-6-3-2-4-7-24/h2-14,19-20,26H,15-18,21-22H2,1H3 |
| InChIKey | RRNPWSXFQNZXHQ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|