C26H26FN3O3 — CID 46160593
N-(3-fluoro-4-methylphenyl)-N-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]benzamide (PubChem CID 46160593) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is N-(3-fluoro-4-methylphenyl)-N-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]benzamide.
| Compound Name | N-(3-fluoro-4-methylphenyl)-N-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46160593 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-(3-fluoro-4-methylphenyl)-N-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]benzamide |
| SMILES | Cc1ccc(N(C(=O)c2ccccc2)C2CCN(Cc3ccc([N+](=O)[O-])cc3)CC2)cc1F |
| InChI | InChI=1S/C26H26FN3O3/c1-19-7-10-24(17-25(19)27)29(26(31)21-5-3-2-4-6-21)22-13-15-28(16-14-22)18-20-8-11-23(12-9-20)30(32)33/h2-12,17,22H,13-16,18H2,1H3 |
| InChIKey | VKJBUNRTGVPOKW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|