C29H27FN2O — CID 42709355
1-benzhydryl-3-(2,6-dimethylphenyl)-1-[(4-fluorophenyl)methyl]urea (PubChem CID 42709355) has the molecular formula C29H27FN2O and a molecular weight of 438.55 g/mol. Its IUPAC name is 1-benzhydryl-3-(2,6-dimethylphenyl)-1-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-benzhydryl-3-(2,6-dimethylphenyl)-1-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 42709355 |
| Molecular Formula | C29H27FN2O |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-benzhydryl-3-(2,6-dimethylphenyl)-1-[(4-fluorophenyl)methyl]urea |
| SMILES | Cc1cccc(C)c1NC(=O)N(Cc1ccc(F)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27FN2O/c1-21-10-9-11-22(2)27(21)31-29(33)32(20-23-16-18-26(30)19-17-23)28(24-12-5-3-6-13-24)25-14-7-4-8-15-25/h3-19,28H,20H2,1-2H3,(H,31,33) |
| InChIKey | PZKMDJCDHLKSNT-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |