C27H34FN5O4 — CID 42709597
4-[2-[cyclohexanecarbonyl-[(4-fluorophenyl)methyl]amino]ethyl]-N-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 42709597) has the molecular formula C27H34FN5O4 and a molecular weight of 511.60 g/mol. Its IUPAC name is 4-[2-[cyclohexanecarbonyl-[(4-fluorophenyl)methyl]amino]ethyl]-N-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-[cyclohexanecarbonyl-[(4-fluorophenyl)methyl]amino]ethyl]-N-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42709597 |
| Molecular Formula | C27H34FN5O4 |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 4-[2-[cyclohexanecarbonyl-[(4-fluorophenyl)methyl]amino]ethyl]-N-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)N1CCN(CCN(Cc2ccc(F)cc2)C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C27H34FN5O4/c28-23-8-6-21(7-9-23)20-32(26(34)22-4-2-1-3-5-22)19-16-30-14-17-31(18-15-30)27(35)29-24-10-12-25(13-11-24)33(36)37/h6-13,22H,1-5,14-20H2,(H,29,35) |
| InChIKey | KHTKZKOBJVXZFE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|