C31H46FN5O2 — CID 3371076
N-(4-ethylphenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide (PubChem CID 3371076) has the molecular formula C31H46FN5O2 and a molecular weight of 539.74 g/mol. Its IUPAC name is N-(4-ethylphenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide.
| Compound Name | N-(4-ethylphenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3371076 |
| Molecular Formula | C31H46FN5O2 |
| Molecular Weight | 539.74 g/mol |
| Exact Mass | 539.36 |
| IUPAC Name | N-(4-ethylphenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)N(CCN1CCN(C(=O)Nc2ccc(CC)cc2)CC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C31H46FN5O2/c1-3-5-6-7-8-9-18-33-30(38)37(25-27-10-14-28(32)15-11-27)24-21-35-19-22-36(23-20-35)31(39)34-29-16-12-26(4-2)13-17-29/h10-17H,3-9,18-25H2,1-2H3,(H,33,38)(H,34,39) |
| InChIKey | OARXOMCVSXROJB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.74 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|