C26H43FN4O2 — CID 42709552
1-[(4-fluorophenyl)methyl]-1-[2-(4-nonanoylpiperazin-1-yl)ethyl]-3-propan-2-ylurea (PubChem CID 42709552) has the molecular formula C26H43FN4O2 and a molecular weight of 462.65 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1-[2-(4-nonanoylpiperazin-1-yl)ethyl]-3-propan-2-ylurea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1-[2-(4-nonanoylpiperazin-1-yl)ethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 42709552 |
| Molecular Formula | C26H43FN4O2 |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.34 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1-[2-(4-nonanoylpiperazin-1-yl)ethyl]-3-propan-2-ylurea |
| SMILES | CCCCCCCCC(=O)N1CCN(CCN(Cc2ccc(F)cc2)C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C26H43FN4O2/c1-4-5-6-7-8-9-10-25(32)30-18-15-29(16-19-30)17-20-31(26(33)28-22(2)3)21-23-11-13-24(27)14-12-23/h11-14,22H,4-10,15-21H2,1-3H3,(H,28,33) |
| InChIKey | KADFKWGDXRLUTC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|