C33H44FN5O2 — CID 42710311
4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]-N-naphthalen-1-ylpiperazine-1-carboxamide (PubChem CID 42710311) has the molecular formula C33H44FN5O2 and a molecular weight of 561.75 g/mol. Its IUPAC name is 4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]-N-naphthalen-1-ylpiperazine-1-carboxamide.
| Compound Name | 4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]-N-naphthalen-1-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 42710311 |
| Molecular Formula | C33H44FN5O2 |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.35 |
| IUPAC Name | 4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]-N-naphthalen-1-ylpiperazine-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)N(CCN1CCN(C(=O)Nc2cccc3ccccc23)CC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C33H44FN5O2/c1-2-3-4-5-6-9-19-35-32(40)39(26-27-15-17-29(34)18-16-27)25-22-37-20-23-38(24-21-37)33(41)36-31-14-10-12-28-11-7-8-13-30(28)31/h7-8,10-18H,2-6,9,19-26H2,1H3,(H,35,40)(H,36,41) |
| InChIKey | XKXHRSKDFHDMNC-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|