C29H41ClFN5O2 — CID 42710309
N-(3-chlorophenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide (PubChem CID 42710309) has the molecular formula C29H41ClFN5O2 and a molecular weight of 546.13 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42710309 |
| Molecular Formula | C29H41ClFN5O2 |
| Molecular Weight | 546.13 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | N-(3-chlorophenyl)-4-[2-[(4-fluorophenyl)methyl-(octylcarbamoyl)amino]ethyl]piperazine-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)N(CCN1CCN(C(=O)Nc2cccc(Cl)c2)CC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C29H41ClFN5O2/c1-2-3-4-5-6-7-15-32-28(37)36(23-24-11-13-26(31)14-12-24)21-18-34-16-19-35(20-17-34)29(38)33-27-10-8-9-25(30)22-27/h8-14,22H,2-7,15-21,23H2,1H3,(H,32,37)(H,33,38) |
| InChIKey | WZJREZTWTLYIOG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.13 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|