C28H41FN4O2S — CID 42724750
1-[(4-fluorophenyl)methyl]-3-octyl-1-[2-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]ethyl]urea (PubChem CID 42724750) has the molecular formula C28H41FN4O2S and a molecular weight of 516.73 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-octyl-1-[2-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]ethyl]urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-octyl-1-[2-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 42724750 |
| Molecular Formula | C28H41FN4O2S |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-octyl-1-[2-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]ethyl]urea |
| SMILES | CCCCCCCCNC(=O)N(CCN1CCN(C(=O)Cc2cccs2)CC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C28H41FN4O2S/c1-2-3-4-5-6-7-14-30-28(35)33(23-24-10-12-25(29)13-11-24)20-17-31-15-18-32(19-16-31)27(34)22-26-9-8-21-36-26/h8-13,21H,2-7,14-20,22-23H2,1H3,(H,30,35) |
| InChIKey | SHSNEXSUUHZHCK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|