C30H43FN4O2 — CID 42657771
1-[(4-fluorophenyl)methyl]-1-[2-[4-(4-methylbenzoyl)piperazin-1-yl]ethyl]-3-octylurea (PubChem CID 42657771) has the molecular formula C30H43FN4O2 and a molecular weight of 510.70 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1-[2-[4-(4-methylbenzoyl)piperazin-1-yl]ethyl]-3-octylurea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1-[2-[4-(4-methylbenzoyl)piperazin-1-yl]ethyl]-3-octylurea |
|---|---|
| PubChem CID | 42657771 |
| Molecular Formula | C30H43FN4O2 |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1-[2-[4-(4-methylbenzoyl)piperazin-1-yl]ethyl]-3-octylurea |
| SMILES | CCCCCCCCNC(=O)N(CCN1CCN(C(=O)c2ccc(C)cc2)CC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C30H43FN4O2/c1-3-4-5-6-7-8-17-32-30(37)35(24-26-11-15-28(31)16-12-26)23-20-33-18-21-34(22-19-33)29(36)27-13-9-25(2)10-14-27/h9-16H,3-8,17-24H2,1-2H3,(H,32,37) |
| InChIKey | SNGWVVDETASSDT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|