C22H38FN5O — CID 55912295
1-[2-(dimethylamino)ethyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1-[(4-fluorophenyl)methyl]urea (PubChem CID 55912295) has the molecular formula C22H38FN5O and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1-[(4-fluorophenyl)methyl]urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 55912295 |
| Molecular Formula | C22H38FN5O |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.31 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1-[(4-fluorophenyl)methyl]urea |
| SMILES | CCN1CCN(CCCCNC(=O)N(CCN(C)C)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H38FN5O/c1-4-26-14-16-27(17-15-26)12-6-5-11-24-22(29)28(18-13-25(2)3)19-20-7-9-21(23)10-8-20/h7-10H,4-6,11-19H2,1-3H3,(H,24,29) |
| InChIKey | ZCOLTPYAPJGXDE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|