C19H30FN3O — CID 55912931
3-(2-cyclopentylethyl)-1-[2-(dimethylamino)ethyl]-1-[(4-fluorophenyl)methyl]urea (PubChem CID 55912931) has the molecular formula C19H30FN3O and a molecular weight of 335.47 g/mol. Its IUPAC name is 3-(2-cyclopentylethyl)-1-[2-(dimethylamino)ethyl]-1-[(4-fluorophenyl)methyl]urea.
| Compound Name | 3-(2-cyclopentylethyl)-1-[2-(dimethylamino)ethyl]-1-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 55912931 |
| Molecular Formula | C19H30FN3O |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 3-(2-cyclopentylethyl)-1-[2-(dimethylamino)ethyl]-1-[(4-fluorophenyl)methyl]urea |
| SMILES | CN(C)CCN(Cc1ccc(F)cc1)C(=O)NCCC1CCCC1 |
| InChI | InChI=1S/C19H30FN3O/c1-22(2)13-14-23(15-17-7-9-18(20)10-8-17)19(24)21-12-11-16-5-3-4-6-16/h7-10,16H,3-6,11-15H2,1-2H3,(H,21,24) |
| InChIKey | RDQKFSJNKWAQGN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |