C25H40FN3O2 — CID 42709634
N-[(4-fluorophenyl)methyl]-N-[2-(4-heptanoylpiperazin-1-yl)ethyl]pentanamide (PubChem CID 42709634) has the molecular formula C25H40FN3O2 and a molecular weight of 433.61 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[2-(4-heptanoylpiperazin-1-yl)ethyl]pentanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[2-(4-heptanoylpiperazin-1-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 42709634 |
| Molecular Formula | C25H40FN3O2 |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[2-(4-heptanoylpiperazin-1-yl)ethyl]pentanamide |
| SMILES | CCCCCCC(=O)N1CCN(CCN(Cc2ccc(F)cc2)C(=O)CCCC)CC1 |
| InChI | InChI=1S/C25H40FN3O2/c1-3-5-7-8-10-24(30)28-18-15-27(16-19-28)17-20-29(25(31)9-6-4-2)21-22-11-13-23(26)14-12-22/h11-14H,3-10,15-21H2,1-2H3 |
| InChIKey | LHYZIYWCAMJGBQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|