C22H34FN3O2 — CID 42710183
N-[(4-fluorophenyl)methyl]-N-[2-(4-propanoylpiperazin-1-yl)ethyl]hexanamide (PubChem CID 42710183) has the molecular formula C22H34FN3O2 and a molecular weight of 391.53 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[2-(4-propanoylpiperazin-1-yl)ethyl]hexanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[2-(4-propanoylpiperazin-1-yl)ethyl]hexanamide |
|---|---|
| PubChem CID | 42710183 |
| Molecular Formula | C22H34FN3O2 |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[2-(4-propanoylpiperazin-1-yl)ethyl]hexanamide |
| SMILES | CCCCCC(=O)N(CCN1CCN(C(=O)CC)CC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H34FN3O2/c1-3-5-6-7-22(28)26(18-19-8-10-20(23)11-9-19)17-14-24-12-15-25(16-13-24)21(27)4-2/h8-11H,3-7,12-18H2,1-2H3 |
| InChIKey | IDRLLBMXFYPRDA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|