C26H20ClN4O3+ — CID 4270981
1-(3-chlorophenyl)-3-(2-methyl-3-oxo-5-phenyl-1H-pyrazol-4-yl)-4-(3-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione (PubChem CID 4270981) has the molecular formula C26H20ClN4O3+ and a molecular weight of 471.92 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(2-methyl-3-oxo-5-phenyl-1H-pyrazol-4-yl)-4-(3-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione.
| Compound Name | 1-(3-chlorophenyl)-3-(2-methyl-3-oxo-5-phenyl-1H-pyrazol-4-yl)-4-(3-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 4270981 |
| Molecular Formula | C26H20ClN4O3+ |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(2-methyl-3-oxo-5-phenyl-1H-pyrazol-4-yl)-4-(3-methylpyridin-1-ium-1-yl)pyrrole-2,5-dione |
| SMILES | Cc1ccc[n+](C2=C(c3c(-c4ccccc4)[nH]n(C)c3=O)C(=O)N(c3cccc(Cl)c3)C2=O)c1 |
| InChI | InChI=1S/C26H19ClN4O3/c1-16-8-7-13-30(15-16)23-21(25(33)31(26(23)34)19-12-6-11-18(27)14-19)20-22(28-29(2)24(20)32)17-9-4-3-5-10-17/h3-15H,1-2H3/p+1 |
| InChIKey | XTTLHUICMSORTL-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|