C28H29N3O3 — CID 42711354
N-[1-(3-benzyl-4-oxoquinazolin-2-yl)ethyl]-N-(furan-2-ylmethyl)cyclopentanecarboxamide (PubChem CID 42711354) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[1-(3-benzyl-4-oxoquinazolin-2-yl)ethyl]-N-(furan-2-ylmethyl)cyclopentanecarboxamide.
| Compound Name | N-[1-(3-benzyl-4-oxoquinazolin-2-yl)ethyl]-N-(furan-2-ylmethyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42711354 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[1-(3-benzyl-4-oxoquinazolin-2-yl)ethyl]-N-(furan-2-ylmethyl)cyclopentanecarboxamide |
| SMILES | CC(c1nc2ccccc2c(=O)n1Cc1ccccc1)N(Cc1ccco1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C28H29N3O3/c1-20(30(19-23-14-9-17-34-23)27(32)22-12-5-6-13-22)26-29-25-16-8-7-15-24(25)28(33)31(26)18-21-10-3-2-4-11-21/h2-4,7-11,14-17,20,22H,5-6,12-13,18-19H2,1H3 |
| InChIKey | GFRQZJUBDMFIHA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |