C27H33N3O2 — CID 42713487
N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]-N-(2-phenylethyl)cyclopentanecarboxamide (PubChem CID 42713487) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]-N-(2-phenylethyl)cyclopentanecarboxamide.
| Compound Name | N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]-N-(2-phenylethyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 42713487 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | N-[1-(4-oxo-3-propylquinazolin-2-yl)ethyl]-N-(2-phenylethyl)cyclopentanecarboxamide |
| SMILES | CCCn1c(C(C)N(CCc2ccccc2)C(=O)C2CCCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H33N3O2/c1-3-18-30-25(28-24-16-10-9-15-23(24)27(30)32)20(2)29(26(31)22-13-7-8-14-22)19-17-21-11-5-4-6-12-21/h4-6,9-12,15-16,20,22H,3,7-8,13-14,17-19H2,1-2H3 |
| InChIKey | BPANTROILDINEQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |