C22H26N4O2S — CID 42714658
3-methyl-2-[1-[3-methyl-4-(thiophene-2-carbonyl)piperazin-1-yl]propyl]quinazolin-4-one (PubChem CID 42714658) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 3-methyl-2-[1-[3-methyl-4-(thiophene-2-carbonyl)piperazin-1-yl]propyl]quinazolin-4-one.
| Compound Name | 3-methyl-2-[1-[3-methyl-4-(thiophene-2-carbonyl)piperazin-1-yl]propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42714658 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-methyl-2-[1-[3-methyl-4-(thiophene-2-carbonyl)piperazin-1-yl]propyl]quinazolin-4-one |
| SMILES | CCC(c1nc2ccccc2c(=O)n1C)N1CCN(C(=O)c2cccs2)C(C)C1 |
| InChI | InChI=1S/C22H26N4O2S/c1-4-18(20-23-17-9-6-5-8-16(17)21(27)24(20)3)25-11-12-26(15(2)14-25)22(28)19-10-7-13-29-19/h5-10,13,15,18H,4,11-12,14H2,1-3H3 |
| InChIKey | JWBCITMZUYGDRQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |