C30H38N4O2 — CID 42714917
3-benzyl-2-[1-[4-(cyclohexanecarbonyl)-3-methylpiperazin-1-yl]propyl]quinazolin-4-one (PubChem CID 42714917) has the molecular formula C30H38N4O2 and a molecular weight of 486.66 g/mol. Its IUPAC name is 3-benzyl-2-[1-[4-(cyclohexanecarbonyl)-3-methylpiperazin-1-yl]propyl]quinazolin-4-one.
| Compound Name | 3-benzyl-2-[1-[4-(cyclohexanecarbonyl)-3-methylpiperazin-1-yl]propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42714917 |
| Molecular Formula | C30H38N4O2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 3-benzyl-2-[1-[4-(cyclohexanecarbonyl)-3-methylpiperazin-1-yl]propyl]quinazolin-4-one |
| SMILES | CCC(c1nc2ccccc2c(=O)n1Cc1ccccc1)N1CCN(C(=O)C2CCCCC2)C(C)C1 |
| InChI | InChI=1S/C30H38N4O2/c1-3-27(32-18-19-33(22(2)20-32)29(35)24-14-8-5-9-15-24)28-31-26-17-11-10-16-25(26)30(36)34(28)21-23-12-6-4-7-13-23/h4,6-7,10-13,16-17,22,24,27H,3,5,8-9,14-15,18-21H2,1-2H3 |
| InChIKey | KKHYVCURVQFKOC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |