C29H36N4O2 — CID 42714908
3-benzyl-2-[1-[4-(cyclohexanecarbonyl)piperazin-1-yl]propyl]quinazolin-4-one (PubChem CID 42714908) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 3-benzyl-2-[1-[4-(cyclohexanecarbonyl)piperazin-1-yl]propyl]quinazolin-4-one.
| Compound Name | 3-benzyl-2-[1-[4-(cyclohexanecarbonyl)piperazin-1-yl]propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42714908 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 3-benzyl-2-[1-[4-(cyclohexanecarbonyl)piperazin-1-yl]propyl]quinazolin-4-one |
| SMILES | CCC(c1nc2ccccc2c(=O)n1Cc1ccccc1)N1CCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C29H36N4O2/c1-2-26(31-17-19-32(20-18-31)28(34)23-13-7-4-8-14-23)27-30-25-16-10-9-15-24(25)29(35)33(27)21-22-11-5-3-6-12-22/h3,5-6,9-12,15-16,23,26H,2,4,7-8,13-14,17-21H2,1H3 |
| InChIKey | YDAJPANORDFJEH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |