C26H34N4O — CID 22058093
3-benzyl-2-[1-[3-[(dimethylamino)methyl]piperidin-1-yl]propyl]quinazolin-4-one (PubChem CID 22058093) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 3-benzyl-2-[1-[3-[(dimethylamino)methyl]piperidin-1-yl]propyl]quinazolin-4-one.
| Compound Name | 3-benzyl-2-[1-[3-[(dimethylamino)methyl]piperidin-1-yl]propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 22058093 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 3-benzyl-2-[1-[3-[(dimethylamino)methyl]piperidin-1-yl]propyl]quinazolin-4-one |
| SMILES | CCC(c1nc2ccccc2c(=O)n1Cc1ccccc1)N1CCCC(CN(C)C)C1 |
| InChI | InChI=1S/C26H34N4O/c1-4-24(29-16-10-13-21(18-29)17-28(2)3)25-27-23-15-9-8-14-22(23)26(31)30(25)19-20-11-6-5-7-12-20/h5-9,11-12,14-15,21,24H,4,10,13,16-19H2,1-3H3 |
| InChIKey | SCDAYSFYECKCBJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |