C31H34N4O3 — CID 42714912
3-benzyl-2-[1-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]propyl]quinazolin-4-one (PubChem CID 42714912) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is 3-benzyl-2-[1-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]propyl]quinazolin-4-one.
| Compound Name | 3-benzyl-2-[1-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42714912 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 3-benzyl-2-[1-[4-(2-phenylmethoxyacetyl)piperazin-1-yl]propyl]quinazolin-4-one |
| SMILES | CCC(c1nc2ccccc2c(=O)n1Cc1ccccc1)N1CCN(C(=O)COCc2ccccc2)CC1 |
| InChI | InChI=1S/C31H34N4O3/c1-2-28(33-17-19-34(20-18-33)29(36)23-38-22-25-13-7-4-8-14-25)30-32-27-16-10-9-15-26(27)31(37)35(30)21-24-11-5-3-6-12-24/h3-16,28H,2,17-23H2,1H3 |
| InChIKey | JYBNPSDEGFMUKZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |