C27H32N4O3 — CID 42715002
3-(2-methoxyethyl)-2-[1-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]propyl]quinazolin-4-one (PubChem CID 42715002) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-2-[1-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]propyl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyethyl)-2-[1-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]propyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42715002 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 3-(2-methoxyethyl)-2-[1-[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]propyl]quinazolin-4-one |
| SMILES | CCC(c1nc2ccccc2c(=O)n1CCOC)N1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N4O3/c1-3-24(26-28-23-12-8-7-11-22(23)27(33)31(26)19-20-34-2)29-15-17-30(18-16-29)25(32)14-13-21-9-5-4-6-10-21/h4-14,24H,3,15-20H2,1-2H3/b14-13+ |
| InChIKey | UDDQNXGVXCGSRI-BUHFOSPRSA-N |
| XLogP | 3.35 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|