C29H30FN3O3 — CID 42716924
2-fluoro-N-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)benzamide (PubChem CID 42716924) has the molecular formula C29H30FN3O3 and a molecular weight of 487.58 g/mol. Its IUPAC name is 2-fluoro-N-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)benzamide.
| Compound Name | 2-fluoro-N-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 42716924 |
| Molecular Formula | C29H30FN3O3 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 2-fluoro-N-[1-[3-(4-methoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-N-(3-methylbutyl)benzamide |
| SMILES | COc1ccc(-n2c(C(C)N(CCC(C)C)C(=O)c3ccccc3F)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C29H30FN3O3/c1-19(2)17-18-32(28(34)23-9-5-7-11-25(23)30)20(3)27-31-26-12-8-6-10-24(26)29(35)33(27)21-13-15-22(36-4)16-14-21/h5-16,19-20H,17-18H2,1-4H3 |
| InChIKey | PHEWZJGEEMHQRU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |