C32H28FN3O2 — CID 42721898
N-benzyl-N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-2-fluorobenzamide (PubChem CID 42721898) has the molecular formula C32H28FN3O2 and a molecular weight of 505.59 g/mol. Its IUPAC name is N-benzyl-N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-2-fluorobenzamide.
| Compound Name | N-benzyl-N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 42721898 |
| Molecular Formula | C32H28FN3O2 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | N-benzyl-N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]ethyl]-2-fluorobenzamide |
| SMILES | CCc1ccc(-n2c(C(C)N(Cc3ccccc3)C(=O)c3ccccc3F)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C32H28FN3O2/c1-3-23-17-19-25(20-18-23)36-30(34-29-16-10-8-14-27(29)32(36)38)22(2)35(21-24-11-5-4-6-12-24)31(37)26-13-7-9-15-28(26)33/h4-20,22H,3,21H2,1-2H3 |
| InChIKey | IGUOJANJLUXMIV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |