C32H29N3O2 — CID 42719081
N-benzyl-2-methyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide (PubChem CID 42719081) has the molecular formula C32H29N3O2 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-benzyl-2-methyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide.
| Compound Name | N-benzyl-2-methyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 42719081 |
| Molecular Formula | C32H29N3O2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | N-benzyl-2-methyl-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide |
| SMILES | Cc1cccc(-n2c(C(C)N(Cc3ccccc3)C(=O)c3ccccc3C)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C32H29N3O2/c1-22-12-11-16-26(20-22)35-30(33-29-19-10-9-18-28(29)32(35)37)24(3)34(21-25-14-5-4-6-15-25)31(36)27-17-8-7-13-23(27)2/h4-20,24H,21H2,1-3H3 |
| InChIKey | DAGQEBJKTVWKRS-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |