C30H33N3O2 — CID 42719036
4-methyl-N-(3-methylbutyl)-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide (PubChem CID 42719036) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-methyl-N-(3-methylbutyl)-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide.
| Compound Name | 4-methyl-N-(3-methylbutyl)-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 42719036 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 4-methyl-N-(3-methylbutyl)-N-[1-[3-(3-methylphenyl)-4-oxoquinazolin-2-yl]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)N(CCC(C)C)C(C)c2nc3ccccc3c(=O)n2-c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C30H33N3O2/c1-20(2)17-18-32(29(34)24-15-13-21(3)14-16-24)23(5)28-31-27-12-7-6-11-26(27)30(35)33(28)25-10-8-9-22(4)19-25/h6-16,19-20,23H,17-18H2,1-5H3 |
| InChIKey | JSSHPUBQKCWCST-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |