C34H25Cl2N3O2 — CID 4560753
N-benzyl-2,4-dichloro-N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]benzamide (PubChem CID 4560753) has the molecular formula C34H25Cl2N3O2 and a molecular weight of 578.50 g/mol. Its IUPAC name is N-benzyl-2,4-dichloro-N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]benzamide.
| Compound Name | N-benzyl-2,4-dichloro-N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 4560753 |
| Molecular Formula | C34H25Cl2N3O2 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | N-benzyl-2,4-dichloro-N-[1-(3-naphthalen-2-yl-4-oxoquinazolin-2-yl)ethyl]benzamide |
| SMILES | CC(c1nc2ccccc2c(=O)n1-c1ccc2ccccc2c1)N(Cc1ccccc1)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C34H25Cl2N3O2/c1-22(38(21-23-9-3-2-4-10-23)33(40)28-18-16-26(35)20-30(28)36)32-37-31-14-8-7-13-29(31)34(41)39(32)27-17-15-24-11-5-6-12-25(24)19-27/h2-20,22H,21H2,1H3 |
| InChIKey | MMKQGURMLKOVPQ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |