C27H28N4O4 — CID 42722210
1-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2-methoxyphenyl)-1-methylurea (PubChem CID 42722210) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 1-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2-methoxyphenyl)-1-methylurea.
| Compound Name | 1-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2-methoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 42722210 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 1-[1-[3-(2-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-3-(2-methoxyphenyl)-1-methylurea |
| SMILES | CCOc1ccccc1-n1c(C(C)N(C)C(=O)Nc2ccccc2OC)nc2ccccc2c1=O |
| InChI | InChI=1S/C27H28N4O4/c1-5-35-24-17-11-9-15-22(24)31-25(28-20-13-7-6-12-19(20)26(31)32)18(2)30(3)27(33)29-21-14-8-10-16-23(21)34-4/h6-18H,5H2,1-4H3,(H,29,33) |
| InChIKey | WXBZWORSJZKZFU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |