C32H30N4O5 — CID 42722907
N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(furan-2-ylmethyl)-4-methyl-3-nitrobenzamide (PubChem CID 42722907) has the molecular formula C32H30N4O5 and a molecular weight of 550.62 g/mol. Its IUPAC name is N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(furan-2-ylmethyl)-4-methyl-3-nitrobenzamide.
| Compound Name | N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(furan-2-ylmethyl)-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 42722907 |
| Molecular Formula | C32H30N4O5 |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N-[1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]propyl]-N-(furan-2-ylmethyl)-4-methyl-3-nitrobenzamide |
| SMILES | CCc1ccc(-n2c(C(CC)N(Cc3ccco3)C(=O)c3ccc(C)c([N+](=O)[O-])c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C32H30N4O5/c1-4-22-13-16-24(17-14-22)35-30(33-27-11-7-6-10-26(27)32(35)38)28(5-2)34(20-25-9-8-18-41-25)31(37)23-15-12-21(3)29(19-23)36(39)40/h6-19,28H,4-5,20H2,1-3H3 |
| InChIKey | RESMPHHFIKIMEL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 111.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|