C36H36N4O7 — CID 42657744
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methyl-3-nitrobenzamide (PubChem CID 42657744) has the molecular formula C36H36N4O7 and a molecular weight of 636.71 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 42657744 |
| Molecular Formula | C36H36N4O7 |
| Molecular Weight | 636.71 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-[3-(4-ethoxyphenyl)-4-oxoquinazolin-2-yl]ethyl]-4-methyl-3-nitrobenzamide |
| SMILES | CCOc1ccc(-n2c(C(C)N(CCc3ccc(OC)c(OC)c3)C(=O)c3ccc(C)c([N+](=O)[O-])c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C36H36N4O7/c1-6-47-28-16-14-27(15-17-28)39-34(37-30-10-8-7-9-29(30)36(39)42)24(3)38(20-19-25-12-18-32(45-4)33(21-25)46-5)35(41)26-13-11-23(2)31(22-26)40(43)44/h7-18,21-22,24H,6,19-20H2,1-5H3 |
| InChIKey | IFQYQLNWYHVOLX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 126.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.71 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|