C30H37ClN4O2 — CID 42724592
1-[2-(4-benzoylpiperazin-1-yl)ethyl]-3-(4-chlorophenyl)-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]urea (PubChem CID 42724592) has the molecular formula C30H37ClN4O2 and a molecular weight of 521.11 g/mol. Its IUPAC name is 1-[2-(4-benzoylpiperazin-1-yl)ethyl]-3-(4-chlorophenyl)-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]urea.
| Compound Name | 1-[2-(4-benzoylpiperazin-1-yl)ethyl]-3-(4-chlorophenyl)-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]urea |
|---|---|
| PubChem CID | 42724592 |
| Molecular Formula | C30H37ClN4O2 |
| Molecular Weight | 521.11 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 1-[2-(4-benzoylpiperazin-1-yl)ethyl]-3-(4-chlorophenyl)-1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]urea |
| SMILES | CC1(C)C2CC=C(CN(CCN3CCN(C(=O)c4ccccc4)CC3)C(=O)Nc3ccc(Cl)cc3)C1C2 |
| InChI | InChI=1S/C30H37ClN4O2/c1-30(2)24-9-8-23(27(30)20-24)21-35(29(37)32-26-12-10-25(31)11-13-26)19-16-33-14-17-34(18-15-33)28(36)22-6-4-3-5-7-22/h3-8,10-13,24,27H,9,14-21H2,1-2H3,(H,32,37) |
| InChIKey | FQCCUKNUTNGYQH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.11 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|