C26H38N6O4 — CID 42708868
4-[2-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl-(ethylcarbamoyl)amino]ethyl]-N-(4-nitrophenyl)piperazine-1-carboxamide (PubChem CID 42708868) has the molecular formula C26H38N6O4 and a molecular weight of 498.63 g/mol. Its IUPAC name is 4-[2-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl-(ethylcarbamoyl)amino]ethyl]-N-(4-nitrophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl-(ethylcarbamoyl)amino]ethyl]-N-(4-nitrophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42708868 |
| Molecular Formula | C26H38N6O4 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 4-[2-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl-(ethylcarbamoyl)amino]ethyl]-N-(4-nitrophenyl)piperazine-1-carboxamide |
| SMILES | CCNC(=O)N(CCN1CCN(C(=O)Nc2ccc([N+](=O)[O-])cc2)CC1)CC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C26H38N6O4/c1-4-27-24(33)31(18-19-5-6-20-17-23(19)26(20,2)3)16-13-29-11-14-30(15-12-29)25(34)28-21-7-9-22(10-8-21)32(35)36/h5,7-10,20,23H,4,6,11-18H2,1-3H3,(H,27,33)(H,28,34) |
| InChIKey | ZYRXWUVZMIVGSI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|