C29H45N5O3 — CID 42707980
4-[2-[butylcarbamoyl-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]amino]ethyl]-N-(3-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 42707980) has the molecular formula C29H45N5O3 and a molecular weight of 511.71 g/mol. Its IUPAC name is 4-[2-[butylcarbamoyl-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]amino]ethyl]-N-(3-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-[butylcarbamoyl-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]amino]ethyl]-N-(3-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42707980 |
| Molecular Formula | C29H45N5O3 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.35 |
| IUPAC Name | 4-[2-[butylcarbamoyl-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]amino]ethyl]-N-(3-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | CCCCNC(=O)N(CCN1CCN(C(=O)Nc2cccc(OC)c2)CC1)CC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C29H45N5O3/c1-5-6-12-30-27(35)34(21-22-10-11-23-19-26(22)29(23,2)3)18-15-32-13-16-33(17-14-32)28(36)31-24-8-7-9-25(20-24)37-4/h7-10,20,23,26H,5-6,11-19,21H2,1-4H3,(H,30,35)(H,31,36) |
| InChIKey | HZLDQVLDBQKLIW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|