C27H38N4O4 — CID 42725655
N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-2-methyl-N-[2-[4-(4-nitrobenzoyl)piperazin-1-yl]ethyl]propanamide (PubChem CID 42725655) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-2-methyl-N-[2-[4-(4-nitrobenzoyl)piperazin-1-yl]ethyl]propanamide.
| Compound Name | N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-2-methyl-N-[2-[4-(4-nitrobenzoyl)piperazin-1-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 42725655 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-2-methyl-N-[2-[4-(4-nitrobenzoyl)piperazin-1-yl]ethyl]propanamide |
| SMILES | CC(C)C(=O)N(CCN1CCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1)CC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C27H38N4O4/c1-19(2)25(32)30(18-21-5-8-22-17-24(21)27(22,3)4)16-13-28-11-14-29(15-12-28)26(33)20-6-9-23(10-7-20)31(34)35/h5-7,9-10,19,22,24H,8,11-18H2,1-4H3 |
| InChIKey | ASYRFVIJUWEUBM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|