C30H43N3O4 — CID 42708035
N-[2-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]ethyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]hexanamide (PubChem CID 42708035) has the molecular formula C30H43N3O4 and a molecular weight of 509.69 g/mol. Its IUPAC name is N-[2-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]ethyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]hexanamide.
| Compound Name | N-[2-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]ethyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]hexanamide |
|---|---|
| PubChem CID | 42708035 |
| Molecular Formula | C30H43N3O4 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | N-[2-[4-(1,3-benzodioxole-5-carbonyl)piperazin-1-yl]ethyl]-N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]hexanamide |
| SMILES | CCCCCC(=O)N(CCN1CCN(C(=O)c2ccc3c(c2)OCO3)CC1)CC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C30H43N3O4/c1-4-5-6-7-28(34)33(20-23-8-10-24-19-25(23)30(24,2)3)17-14-31-12-15-32(16-13-31)29(35)22-9-11-26-27(18-22)37-21-36-26/h8-9,11,18,24-25H,4-7,10,12-17,19-21H2,1-3H3 |
| InChIKey | OUZPIYLPTGAANG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|