C32H49N3O2 — CID 42657751
N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-2-methyl-N-[2-[4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]propanamide (PubChem CID 42657751) has the molecular formula C32H49N3O2 and a molecular weight of 507.76 g/mol. Its IUPAC name is N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-2-methyl-N-[2-[4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]propanamide.
| Compound Name | N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-2-methyl-N-[2-[4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 42657751 |
| Molecular Formula | C32H49N3O2 |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 507.38 |
| IUPAC Name | N-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-2-methyl-N-[2-[4-(4-pentylbenzoyl)piperazin-1-yl]ethyl]propanamide |
| SMILES | CCCCCc1ccc(C(=O)N2CCN(CCN(CC3=CCC4CC3C4(C)C)C(=O)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C32H49N3O2/c1-6-7-8-9-25-10-12-26(13-11-25)31(37)34-19-16-33(17-20-34)18-21-35(30(36)24(2)3)23-27-14-15-28-22-29(27)32(28,4)5/h10-14,24,28-29H,6-9,15-23H2,1-5H3 |
| InChIKey | AQPVALDBAOGFKQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|